C20H19N3O2 — CID 175081872
3-methyl-4-[3-(2-methylprop-2-enoylamino)phenyl]-1H-indole-7-carboxamide (PubChem CID 175081872) has the molecular formula C20H19N3O2 and a molecular weight of 333.39 g/mol. Its IUPAC name is 3-methyl-4-[3-(2-methylprop-2-enoylamino)phenyl]-1H-indole-7-carboxamide.
| Compound Name | 3-methyl-4-[3-(2-methylprop-2-enoylamino)phenyl]-1H-indole-7-carboxamide |
|---|---|
| PubChem CID | 175081872 |
| Molecular Formula | C20H19N3O2 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | 3-methyl-4-[3-(2-methylprop-2-enoylamino)phenyl]-1H-indole-7-carboxamide |
| SMILES | C=C(C)C(=O)Nc1cccc(-c2ccc(C(N)=O)c3[nH]cc(C)c23)c1 |
| InChI | InChI=1S/C20H19N3O2/c1-11(2)20(25)23-14-6-4-5-13(9-14)15-7-8-16(19(21)24)18-17(15)12(3)10-22-18/h4-10,22H,1H2,2-3H3,(H2,21,24)(H,23,25) |
| InChIKey | DTBYVARZCQOIGE-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 87.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|