C13H9FN4O2 — CID 134538290
4-(5-amino-2-fluorophenyl)-7H-pyrrolo[2,3-d]pyrimidine-5-carboxylic acid (PubChem CID 134538290) has the molecular formula C13H9FN4O2 and a molecular weight of 272.24 g/mol. Its IUPAC name is 4-(5-amino-2-fluorophenyl)-7H-pyrrolo[2,3-d]pyrimidine-5-carboxylic acid.
| Compound Name | 4-(5-amino-2-fluorophenyl)-7H-pyrrolo[2,3-d]pyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 134538290 |
| Molecular Formula | C13H9FN4O2 |
| Molecular Weight | 272.24 g/mol |
| Exact Mass | 272.07 |
| IUPAC Name | 4-(5-amino-2-fluorophenyl)-7H-pyrrolo[2,3-d]pyrimidine-5-carboxylic acid |
| SMILES | Nc1ccc(F)c(-c2ncnc3[nH]cc(C(=O)O)c23)c1 |
| InChI | InChI=1S/C13H9FN4O2/c14-9-2-1-6(15)3-7(9)11-10-8(13(19)20)4-16-12(10)18-5-17-11/h1-5H,15H2,(H,19,20)(H,16,17,18) |
| InChIKey | BRUPPIWJKGQGCG-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 104.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.24 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|