C6H13Cl2NO5 — CID 134540684
2-amino-2-(hydroxymethyl)propane-1,3-diol;2,2-dichloroacetic acid (PubChem CID 134540684) has the molecular formula C6H13Cl2NO5 and a molecular weight of 250.08 g/mol. Its IUPAC name is 2-amino-2-(hydroxymethyl)propane-1,3-diol;2,2-dichloroacetic acid.
| Compound Name | 2-amino-2-(hydroxymethyl)propane-1,3-diol;2,2-dichloroacetic acid |
|---|---|
| PubChem CID | 134540684 |
| Molecular Formula | C6H13Cl2NO5 |
| Molecular Weight | 250.08 g/mol |
| Exact Mass | 249.02 |
| IUPAC Name | 2-amino-2-(hydroxymethyl)propane-1,3-diol;2,2-dichloroacetic acid |
| SMILES | NC(CO)(CO)CO.O=C(O)C(Cl)Cl |
| InChI | InChI=1S/C4H11NO3.C2H2Cl2O2/c5-4(1-6,2-7)3-8;3-1(4)2(5)6/h6-8H,1-3,5H2;1H,(H,5,6) |
| InChIKey | UNVHBAUPGFAZIJ-UHFFFAOYSA-N |
| XLogP | -1.46 |
| TPSA | 124.01 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.08 |
| LogP ≤ 5 | -1.46 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|