C14H9BrF6N4O2 — CID 134542803
2,2,2-trifluoro-N-[6-(hydroxymethyl)-5-[4-(trifluoromethoxy)phenyl]pyrazin-2-yl]ethanehydrazonoyl bromide (PubChem CID 134542803) has the molecular formula C14H9BrF6N4O2 and a molecular weight of 459.14 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[6-(hydroxymethyl)-5-[4-(trifluoromethoxy)phenyl]pyrazin-2-yl]ethanehydrazonoyl bromide.
| Compound Name | 2,2,2-trifluoro-N-[6-(hydroxymethyl)-5-[4-(trifluoromethoxy)phenyl]pyrazin-2-yl]ethanehydrazonoyl bromide |
|---|---|
| PubChem CID | 134542803 |
| Molecular Formula | C14H9BrF6N4O2 |
| Molecular Weight | 459.14 g/mol |
| Exact Mass | 457.98 |
| IUPAC Name | 2,2,2-trifluoro-N-[6-(hydroxymethyl)-5-[4-(trifluoromethoxy)phenyl]pyrazin-2-yl]ethanehydrazonoyl bromide |
| SMILES | OCc1nc(NN=C(Br)C(F)(F)F)cnc1-c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C14H9BrF6N4O2/c15-12(13(16,17)18)25-24-10-5-22-11(9(6-26)23-10)7-1-3-8(4-2-7)27-14(19,20)21/h1-5,26H,6H2,(H,23,24) |
| InChIKey | HYQGXSCBIMTDOF-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 79.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.14 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|