C13H8Cl2F3NO2 — CID 134623616
[3,5-dichloro-2-[4-(trifluoromethoxy)phenyl]-4-pyridinyl]methanol (PubChem CID 134623616) has the molecular formula C13H8Cl2F3NO2 and a molecular weight of 338.11 g/mol. Its IUPAC name is [3,5-dichloro-2-[4-(trifluoromethoxy)phenyl]-4-pyridinyl]methanol.
| Compound Name | [3,5-dichloro-2-[4-(trifluoromethoxy)phenyl]-4-pyridinyl]methanol |
|---|---|
| PubChem CID | 134623616 |
| Molecular Formula | C13H8Cl2F3NO2 |
| Molecular Weight | 338.11 g/mol |
| Exact Mass | 336.99 |
| IUPAC Name | [3,5-dichloro-2-[4-(trifluoromethoxy)phenyl]-4-pyridinyl]methanol |
| SMILES | OCc1c(Cl)cnc(-c2ccc(OC(F)(F)F)cc2)c1Cl |
| InChI | InChI=1S/C13H8Cl2F3NO2/c14-10-5-19-12(11(15)9(10)6-20)7-1-3-8(4-2-7)21-13(16,17)18/h1-5,20H,6H2 |
| InChIKey | ZLAWHXDXLZHRGA-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.11 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |