C7H4Cl2F3NO — CID 170906648
[3,5-dichloro-2-(trifluoromethyl)-4-pyridinyl]methanol (PubChem CID 170906648) has the molecular formula C7H4Cl2F3NO and a molecular weight of 246.02 g/mol. Its IUPAC name is [3,5-dichloro-2-(trifluoromethyl)-4-pyridinyl]methanol.
| Compound Name | [3,5-dichloro-2-(trifluoromethyl)-4-pyridinyl]methanol |
|---|---|
| PubChem CID | 170906648 |
| Molecular Formula | C7H4Cl2F3NO |
| Molecular Weight | 246.02 g/mol |
| Exact Mass | 244.96 |
| IUPAC Name | [3,5-dichloro-2-(trifluoromethyl)-4-pyridinyl]methanol |
| SMILES | OCc1c(Cl)cnc(C(F)(F)F)c1Cl |
| InChI | InChI=1S/C7H4Cl2F3NO/c8-4-1-13-6(7(10,11)12)5(9)3(4)2-14/h1,14H,2H2 |
| InChIKey | QXZFVINMGQZEMI-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.02 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |