C25H42N8O9 — CID 134545200
2-[4,7-bis(carboxymethyl)-10-[2-[6-(2-nitroimidazol-1-yl)hexylamino]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid (PubChem CID 134545200) has the molecular formula C25H42N8O9 and a molecular weight of 598.66 g/mol. Its IUPAC name is 2-[4,7-bis(carboxymethyl)-10-[2-[6-(2-nitroimidazol-1-yl)hexylamino]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid.
| Compound Name | 2-[4,7-bis(carboxymethyl)-10-[2-[6-(2-nitroimidazol-1-yl)hexylamino]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
|---|---|
| PubChem CID | 134545200 |
| Molecular Formula | C25H42N8O9 |
| Molecular Weight | 598.66 g/mol |
| Exact Mass | 598.31 |
| IUPAC Name | 2-[4,7-bis(carboxymethyl)-10-[2-[6-(2-nitroimidazol-1-yl)hexylamino]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
| SMILES | O=C(O)CN1CCN(CC(=O)O)CCN(CC(=O)NCCCCCCn2ccnc2[N+](=O)[O-])CCN(CC(=O)O)CC1 |
| InChI | InChI=1S/C25H42N8O9/c34-21(26-5-3-1-2-4-7-32-8-6-27-25(32)33(41)42)17-28-9-11-29(18-22(35)36)13-15-31(20-24(39)40)16-14-30(12-10-28)19-23(37)38/h6,8H,1-5,7,9-20H2,(H,26,34)(H,35,36)(H,37,38)(H,39,40) |
| InChIKey | COCVYMUZSLCHSJ-UHFFFAOYSA-N |
| XLogP | -1.06 |
| TPSA | 214.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.66 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|