C26H43N7O7 — CID 141450133
tert-butyl 2-[4-[2-[(2-methylpropan-2-yl)oxy]-3-oxoprop-2-enyl]-7-[2-[[2-(2-nitroimidazol-1-yl)acetyl]amino]ethyl]-1,4,7-triazonan-1-yl]acetate (PubChem CID 141450133) has the molecular formula C26H43N7O7 and a molecular weight of 565.67 g/mol. Its IUPAC name is tert-butyl 2-[4-[2-[(2-methylpropan-2-yl)oxy]-3-oxoprop-2-enyl]-7-[2-[[2-(2-nitroimidazol-1-yl)acetyl]amino]ethyl]-1,4,7-triazonan-1-yl]acetate.
| Compound Name | tert-butyl 2-[4-[2-[(2-methylpropan-2-yl)oxy]-3-oxoprop-2-enyl]-7-[2-[[2-(2-nitroimidazol-1-yl)acetyl]amino]ethyl]-1,4,7-triazonan-1-yl]acetate |
|---|---|
| PubChem CID | 141450133 |
| Molecular Formula | C26H43N7O7 |
| Molecular Weight | 565.67 g/mol |
| Exact Mass | 565.32 |
| IUPAC Name | tert-butyl 2-[4-[2-[(2-methylpropan-2-yl)oxy]-3-oxoprop-2-enyl]-7-[2-[[2-(2-nitroimidazol-1-yl)acetyl]amino]ethyl]-1,4,7-triazonan-1-yl]acetate |
| SMILES | CC(C)(C)OC(=O)CN1CCN(CCNC(=O)Cn2ccnc2[N+](=O)[O-])CCN(CC(=C=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C26H43N7O7/c1-25(2,3)39-21(20-34)17-30-13-11-29(12-14-31(16-15-30)19-23(36)40-26(4,5)6)9-7-27-22(35)18-32-10-8-28-24(32)33(37)38/h8,10H,7,9,11-19H2,1-6H3,(H,27,35) |
| InChIKey | DWDRNNMJCNDPSV-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 152.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.67 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|