C9H10F2N4O3 — CID 148887354
N-[(Z)-2,3-difluorobut-2-enyl]-2-(2-nitroimidazol-1-yl)acetamide (PubChem CID 148887354) has the molecular formula C9H10F2N4O3 and a molecular weight of 260.20 g/mol. Its IUPAC name is N-[(Z)-2,3-difluorobut-2-enyl]-2-(2-nitroimidazol-1-yl)acetamide.
| Compound Name | N-[(Z)-2,3-difluorobut-2-enyl]-2-(2-nitroimidazol-1-yl)acetamide |
|---|---|
| PubChem CID | 148887354 |
| Molecular Formula | C9H10F2N4O3 |
| Molecular Weight | 260.20 g/mol |
| Exact Mass | 260.07 |
| IUPAC Name | N-[(Z)-2,3-difluorobut-2-enyl]-2-(2-nitroimidazol-1-yl)acetamide |
| SMILES | C/C(F)=C(/F)CNC(=O)Cn1ccnc1[N+](=O)[O-] |
| InChI | InChI=1S/C9H10F2N4O3/c1-6(10)7(11)4-13-8(16)5-14-3-2-12-9(14)15(17)18/h2-3H,4-5H2,1H3,(H,13,16)/b7-6- |
| InChIKey | PEFSVFFNBABDEO-SREVYHEPSA-N |
| XLogP | 1.08 |
| TPSA | 90.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.20 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|