C9H8N4O6 — CID 91000221
(2,5-dihydroxypyrrol-1-yl) 2-(2-nitroimidazol-1-yl)acetate (PubChem CID 91000221) has the molecular formula C9H8N4O6 and a molecular weight of 268.19 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 2-(2-nitroimidazol-1-yl)acetate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 2-(2-nitroimidazol-1-yl)acetate |
|---|---|
| PubChem CID | 91000221 |
| Molecular Formula | C9H8N4O6 |
| Molecular Weight | 268.19 g/mol |
| Exact Mass | 268.04 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 2-(2-nitroimidazol-1-yl)acetate |
| SMILES | O=C(Cn1ccnc1[N+](=O)[O-])On1c(O)ccc1O |
| InChI | InChI=1S/C9H8N4O6/c14-6-1-2-7(15)12(6)19-8(16)5-11-4-3-10-9(11)13(17)18/h1-4,14-15H,5H2 |
| InChIKey | DXTUHVLYHTXJLI-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 132.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.19 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|