C15H20F2N2O — CID 134547923
[2-amino-6-(difluoromethyl)phenyl]methyl (Z)-N-ethyl-2-methylbut-2-enimidate (PubChem CID 134547923) has the molecular formula C15H20F2N2O and a molecular weight of 282.33 g/mol. Its IUPAC name is [2-amino-6-(difluoromethyl)phenyl]methyl (Z)-N-ethyl-2-methylbut-2-enimidate.
| Compound Name | [2-amino-6-(difluoromethyl)phenyl]methyl (Z)-N-ethyl-2-methylbut-2-enimidate |
|---|---|
| PubChem CID | 134547923 |
| Molecular Formula | C15H20F2N2O |
| Molecular Weight | 282.33 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | [2-amino-6-(difluoromethyl)phenyl]methyl (Z)-N-ethyl-2-methylbut-2-enimidate |
| SMILES | C/C=C(C)\C(=N/CC)OCc1c(N)cccc1C(F)F |
| InChI | InChI=1S/C15H20F2N2O/c1-4-10(3)15(19-5-2)20-9-12-11(14(16)17)7-6-8-13(12)18/h4,6-8,14H,5,9,18H2,1-3H3/b10-4-,19-15+ |
| InChIKey | GHKRHRVYONJHAG-USKJMMPSSA-N |
| XLogP | 4.11 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.33 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|