C23H21ClN4OS — CID 134548634
N-[(5-chloro-2-ethylsulfanylphenyl)methyl]-1-phenyl-5-pyrrol-1-ylpyrazole-4-carboxamide (PubChem CID 134548634) has the molecular formula C23H21ClN4OS and a molecular weight of 436.97 g/mol. Its IUPAC name is N-[(5-chloro-2-ethylsulfanylphenyl)methyl]-1-phenyl-5-pyrrol-1-ylpyrazole-4-carboxamide.
| Compound Name | N-[(5-chloro-2-ethylsulfanylphenyl)methyl]-1-phenyl-5-pyrrol-1-ylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 134548634 |
| Molecular Formula | C23H21ClN4OS |
| Molecular Weight | 436.97 g/mol |
| Exact Mass | 436.11 |
| IUPAC Name | N-[(5-chloro-2-ethylsulfanylphenyl)methyl]-1-phenyl-5-pyrrol-1-ylpyrazole-4-carboxamide |
| SMILES | CCSc1ccc(Cl)cc1CNC(=O)c1cnn(-c2ccccc2)c1-n1cccc1 |
| InChI | InChI=1S/C23H21ClN4OS/c1-2-30-21-11-10-18(24)14-17(21)15-25-22(29)20-16-26-28(19-8-4-3-5-9-19)23(20)27-12-6-7-13-27/h3-14,16H,2,15H2,1H3,(H,25,29) |
| InChIKey | GHNJOJUYXLFAME-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 51.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.97 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |