C23H28N2O4 — CID 134549704
6-(1-aminoethyl)-2-[[3-methoxy-4-(oxolan-2-ylmethoxy)phenyl]methyl]-3H-isoindol-1-one (PubChem CID 134549704) has the molecular formula C23H28N2O4 and a molecular weight of 396.49 g/mol. Its IUPAC name is 6-(1-aminoethyl)-2-[[3-methoxy-4-(oxolan-2-ylmethoxy)phenyl]methyl]-3H-isoindol-1-one.
| Compound Name | 6-(1-aminoethyl)-2-[[3-methoxy-4-(oxolan-2-ylmethoxy)phenyl]methyl]-3H-isoindol-1-one |
|---|---|
| PubChem CID | 134549704 |
| Molecular Formula | C23H28N2O4 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | 6-(1-aminoethyl)-2-[[3-methoxy-4-(oxolan-2-ylmethoxy)phenyl]methyl]-3H-isoindol-1-one |
| SMILES | COc1cc(CN2Cc3ccc(C(C)N)cc3C2=O)ccc1OCC1CCCO1 |
| InChI | InChI=1S/C23H28N2O4/c1-15(24)17-6-7-18-13-25(23(26)20(18)11-17)12-16-5-8-21(22(10-16)27-2)29-14-19-4-3-9-28-19/h5-8,10-11,15,19H,3-4,9,12-14,24H2,1-2H3 |
| InChIKey | GMKWLTJHQWKYMD-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 74.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |