C20H17F3N4S2 — CID 134549745
5-[2-[2-(2-methylpropyl)-4-pyridinyl]-1,3-thiazol-4-yl]-2-(trifluoromethylsulfanylamino)benzonitrile (PubChem CID 134549745) has the molecular formula C20H17F3N4S2 and a molecular weight of 434.51 g/mol. Its IUPAC name is 5-[2-[2-(2-methylpropyl)-4-pyridinyl]-1,3-thiazol-4-yl]-2-(trifluoromethylsulfanylamino)benzonitrile.
| Compound Name | 5-[2-[2-(2-methylpropyl)-4-pyridinyl]-1,3-thiazol-4-yl]-2-(trifluoromethylsulfanylamino)benzonitrile |
|---|---|
| PubChem CID | 134549745 |
| Molecular Formula | C20H17F3N4S2 |
| Molecular Weight | 434.51 g/mol |
| Exact Mass | 434.08 |
| IUPAC Name | 5-[2-[2-(2-methylpropyl)-4-pyridinyl]-1,3-thiazol-4-yl]-2-(trifluoromethylsulfanylamino)benzonitrile |
| SMILES | CC(C)Cc1cc(-c2nc(-c3ccc(NSC(F)(F)F)c(C#N)c3)cs2)ccn1 |
| InChI | InChI=1S/C20H17F3N4S2/c1-12(2)7-16-9-14(5-6-25-16)19-26-18(11-28-19)13-3-4-17(15(8-13)10-24)27-29-20(21,22)23/h3-6,8-9,11-12,27H,7H2,1-2H3 |
| InChIKey | OMDJRFGGEPQXLX-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.51 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|