C23H28N4OSSi — CID 175692331
2-amino-5-[2-[2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-methyl-4-pyridinyl]-1,3-thiazol-4-yl]benzonitrile (PubChem CID 175692331) has the molecular formula C23H28N4OSSi and a molecular weight of 436.66 g/mol. Its IUPAC name is 2-amino-5-[2-[2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-methyl-4-pyridinyl]-1,3-thiazol-4-yl]benzonitrile.
| Compound Name | 2-amino-5-[2-[2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-methyl-4-pyridinyl]-1,3-thiazol-4-yl]benzonitrile |
|---|---|
| PubChem CID | 175692331 |
| Molecular Formula | C23H28N4OSSi |
| Molecular Weight | 436.66 g/mol |
| Exact Mass | 436.18 |
| IUPAC Name | 2-amino-5-[2-[2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-methyl-4-pyridinyl]-1,3-thiazol-4-yl]benzonitrile |
| SMILES | Cc1cc(-c2nc(-c3ccc(N)c(C#N)c3)cs2)cc(CO[Si](C)(C)C(C)(C)C)n1 |
| InChI | InChI=1S/C23H28N4OSSi/c1-15-9-17(11-19(26-15)13-28-30(5,6)23(2,3)4)22-27-21(14-29-22)16-7-8-20(25)18(10-16)12-24/h7-11,14H,13,25H2,1-6H3 |
| InChIKey | JHAULPWDXIYISV-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 84.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.66 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|