C19H18F3N3S2 — CID 134549821
N-methyl-4-[2-(2-propyl-4-pyridinyl)-1,3-thiazol-4-yl]-N-(trifluoromethylsulfanyl)aniline (PubChem CID 134549821) has the molecular formula C19H18F3N3S2 and a molecular weight of 409.50 g/mol. Its IUPAC name is N-methyl-4-[2-(2-propyl-4-pyridinyl)-1,3-thiazol-4-yl]-N-(trifluoromethylsulfanyl)aniline.
| Compound Name | N-methyl-4-[2-(2-propyl-4-pyridinyl)-1,3-thiazol-4-yl]-N-(trifluoromethylsulfanyl)aniline |
|---|---|
| PubChem CID | 134549821 |
| Molecular Formula | C19H18F3N3S2 |
| Molecular Weight | 409.50 g/mol |
| Exact Mass | 409.09 |
| IUPAC Name | N-methyl-4-[2-(2-propyl-4-pyridinyl)-1,3-thiazol-4-yl]-N-(trifluoromethylsulfanyl)aniline |
| SMILES | CCCc1cc(-c2nc(-c3ccc(N(C)SC(F)(F)F)cc3)cs2)ccn1 |
| InChI | InChI=1S/C19H18F3N3S2/c1-3-4-15-11-14(9-10-23-15)18-24-17(12-26-18)13-5-7-16(8-6-13)25(2)27-19(20,21)22/h5-12H,3-4H2,1-2H3 |
| InChIKey | AIGZJTGSJBIDEL-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.50 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|