C24H23N3S — CID 25012899
N-benzyl-4-[2-(2-propyl-4-pyridinyl)-1,3-thiazol-4-yl]aniline (PubChem CID 25012899) has the molecular formula C24H23N3S and a molecular weight of 385.54 g/mol. Its IUPAC name is N-benzyl-4-[2-(2-propyl-4-pyridinyl)-1,3-thiazol-4-yl]aniline.
| Compound Name | N-benzyl-4-[2-(2-propyl-4-pyridinyl)-1,3-thiazol-4-yl]aniline |
|---|---|
| PubChem CID | 25012899 |
| Molecular Formula | C24H23N3S |
| Molecular Weight | 385.54 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | N-benzyl-4-[2-(2-propyl-4-pyridinyl)-1,3-thiazol-4-yl]aniline |
| SMILES | CCCc1cc(-c2nc(-c3ccc(NCc4ccccc4)cc3)cs2)ccn1 |
| InChI | InChI=1S/C24H23N3S/c1-2-6-22-15-20(13-14-25-22)24-27-23(17-28-24)19-9-11-21(12-10-19)26-16-18-7-4-3-5-8-18/h3-5,7-15,17,26H,2,6,16H2,1H3 |
| InChIKey | BAQOAQCINMPNGC-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.54 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |