C26H22N4O2S2 — CID 141218719
2-[4-[2-(2-propyl-4-pyridinyl)-1,3-thiazol-4-yl]phenyl]quinoline-8-sulfonamide (PubChem CID 141218719) has the molecular formula C26H22N4O2S2 and a molecular weight of 486.62 g/mol. Its IUPAC name is 2-[4-[2-(2-propyl-4-pyridinyl)-1,3-thiazol-4-yl]phenyl]quinoline-8-sulfonamide.
| Compound Name | 2-[4-[2-(2-propyl-4-pyridinyl)-1,3-thiazol-4-yl]phenyl]quinoline-8-sulfonamide |
|---|---|
| PubChem CID | 141218719 |
| Molecular Formula | C26H22N4O2S2 |
| Molecular Weight | 486.62 g/mol |
| Exact Mass | 486.12 |
| IUPAC Name | 2-[4-[2-(2-propyl-4-pyridinyl)-1,3-thiazol-4-yl]phenyl]quinoline-8-sulfonamide |
| SMILES | CCCc1cc(-c2nc(-c3ccc(-c4ccc5cccc(S(N)(=O)=O)c5n4)cc3)cs2)ccn1 |
| InChI | InChI=1S/C26H22N4O2S2/c1-2-4-21-15-20(13-14-28-21)26-30-23(16-33-26)18-9-7-17(8-10-18)22-12-11-19-5-3-6-24(25(19)29-22)34(27,31)32/h3,5-16H,2,4H2,1H3,(H2,27,31,32) |
| InChIKey | VMSWYFBYESFYLP-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 98.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.62 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |