C22H35NO4 — CID 134550238
2-[(7S)-5-[(1E,3E)-5-[3,6-dimethyl-5-(methylamino)oxan-2-yl]-3-methylpenta-1,3-dienyl]-1,6-dioxaspiro[2.5]octan-7-yl]acetaldehyde (PubChem CID 134550238) has the molecular formula C22H35NO4 and a molecular weight of 377.53 g/mol. Its IUPAC name is 2-[(7S)-5-[(1E,3E)-5-[3,6-dimethyl-5-(methylamino)oxan-2-yl]-3-methylpenta-1,3-dienyl]-1,6-dioxaspiro[2.5]octan-7-yl]acetaldehyde.
| Compound Name | 2-[(7S)-5-[(1E,3E)-5-[3,6-dimethyl-5-(methylamino)oxan-2-yl]-3-methylpenta-1,3-dienyl]-1,6-dioxaspiro[2.5]octan-7-yl]acetaldehyde |
|---|---|
| PubChem CID | 134550238 |
| Molecular Formula | C22H35NO4 |
| Molecular Weight | 377.53 g/mol |
| Exact Mass | 377.26 |
| IUPAC Name | 2-[(7S)-5-[(1E,3E)-5-[3,6-dimethyl-5-(methylamino)oxan-2-yl]-3-methylpenta-1,3-dienyl]-1,6-dioxaspiro[2.5]octan-7-yl]acetaldehyde |
| SMILES | CNC1CC(C)C(C/C=C(C)/C=C/C2CC3(CO3)C[C@@H](CC=O)O2)OC1C |
| InChI | InChI=1S/C22H35NO4/c1-15(6-8-21-16(2)11-20(23-4)17(3)26-21)5-7-18-12-22(14-25-22)13-19(27-18)9-10-24/h5-7,10,16-21,23H,8-9,11-14H2,1-4H3/b7-5+,15-6+/t16?,17?,18?,19-,20?,21?,22?/m1/s1 |
| InChIKey | JKQXKAUGAOOUPG-JVUIDYOASA-N |
| XLogP | 3.19 |
| TPSA | 60.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.53 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|