C52H48O2P2 — CID 134550569
2'-diphenylphosphoryl-2-[[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-phenylphosphoryl]-7,7'-dimethylspiro[1,2,3,4,4a,9a-hexahydrofluorene-9,9'-fluorene] (PubChem CID 134550569) has the molecular formula C52H48O2P2 and a molecular weight of 766.90 g/mol. Its IUPAC name is 2'-diphenylphosphoryl-2-[[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-phenylphosphoryl]-7,7'-dimethylspiro[1,2,3,4,4a,9a-hexahydrofluorene-9,9'-fluorene].
| Compound Name | 2'-diphenylphosphoryl-2-[[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-phenylphosphoryl]-7,7'-dimethylspiro[1,2,3,4,4a,9a-hexahydrofluorene-9,9'-fluorene] |
|---|---|
| PubChem CID | 134550569 |
| Molecular Formula | C52H48O2P2 |
| Molecular Weight | 766.90 g/mol |
| Exact Mass | 766.31 |
| IUPAC Name | 2'-diphenylphosphoryl-2-[[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-phenylphosphoryl]-7,7'-dimethylspiro[1,2,3,4,4a,9a-hexahydrofluorene-9,9'-fluorene] |
| SMILES | C=C(/C=C\C=C/C)P(=O)(c1ccccc1)C1CCC2c3ccc(C)cc3C3(c4cc(C)ccc4-c4ccc(P(=O)(c5ccccc5)c5ccccc5)cc43)C2C1 |
| InChI | InChI=1S/C52H48O2P2/c1-5-6-10-17-38(4)55(53,39-18-11-7-12-19-39)42-26-30-46-44-28-24-36(2)32-48(44)52(50(46)34-42)49-33-37(3)25-29-45(49)47-31-27-43(35-51(47)52)56(54,40-20-13-8-14-21-40)41-22-15-9-16-23-41/h5-25,27-29,31-33,35,42,46,50H,4,26,30,34H2,1-3H3/b6-5-,17-10- |
| InChIKey | OFQHNLMOPRNVSP-YVBQQOMXSA-N |
| XLogP | 11.86 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 766.90 |
| LogP ≤ 5 | 11.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|