C45H38 — CID 53423919
2,7-bis(9,9-dimethylfluoren-2-yl)-9,9-dimethylfluorene (PubChem CID 53423919) has the molecular formula C45H38 and a molecular weight of 578.80 g/mol. Its IUPAC name is 2,7-bis(9,9-dimethylfluoren-2-yl)-9,9-dimethylfluorene.
| Compound Name | 2,7-bis(9,9-dimethylfluoren-2-yl)-9,9-dimethylfluorene |
|---|---|
| PubChem CID | 53423919 |
| Molecular Formula | C45H38 |
| Molecular Weight | 578.80 g/mol |
| Exact Mass | 578.30 |
| IUPAC Name | 2,7-bis(9,9-dimethylfluoren-2-yl)-9,9-dimethylfluorene |
| SMILES | CC1(C)c2ccccc2-c2ccc(-c3ccc4c(c3)C(C)(C)c3cc(-c5ccc6c(c5)C(C)(C)c5ccccc5-6)ccc3-4)cc21 |
| InChI | InChI=1S/C45H38/c1-43(2)37-13-9-7-11-31(37)33-19-15-27(23-39(33)43)29-17-21-35-36-22-18-30(26-42(36)45(5,6)41(35)25-29)28-16-20-34-32-12-8-10-14-38(32)44(3,4)40(34)24-28/h7-26H,1-6H3 |
| InChIKey | CCTIZDABNPLPHW-UHFFFAOYSA-N |
| XLogP | 11.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.80 |
| LogP ≤ 5 | 11.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |