About Dibenzo[j,l]fluoranthene
Dibenzo[j,l]fluoranthene (PubChem CID 6428082) has the molecular formula C24H14
and a molecular weight of 302.40 g/mol. Its IUPAC name is hexacyclo[14.7.1.02,15.03,8.09,14.020,24]tetracosa-1(23),2(15),3,5,7,9,11,13,16,18,20(24),21-dodecaene.
Molecular Properties
| Compound Name | Dibenzo[j,l]fluoranthene |
| PubChem CID | 6428082 |
| Molecular Formula | C24H14 |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | hexacyclo[14.7.1.02,15.03,8.09,14.020,24]tetracosa-1(23),2(15),3,5,7,9,11,13,16,18,20(24),21-dodecaene |
| SMILES | C1=CC=C2C(=C1)C3=CC=CC=C3C4=C2C5=CC=CC6=C5C4=CC=C6 |
| InChI | InChI=1S/C24H14/c1-3-11-18-16(9-1)17-10-2-4-12-19(17)24-21-14-6-8-15-7-5-13-20(22(15)21)23(18)24/h1-14H |
| InChIKey | JYVYSXOKKXPQHQ-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | 438 |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze Dibenzo[j,l]fluoranthene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Dibenzo[j,l]fluoranthene?
The IUPAC name of Dibenzo[j,l]fluoranthene (CID 6428082) is hexacyclo[14.7.1.02,15.03,8.09,14.020,24]tetracosa-1(23),2(15),3,5,7,9,11,13,16,18,20(24),21-dodecaene.
What is the SMILES notation for Dibenzo[j,l]fluoranthene?
The canonical SMILES for Dibenzo[j,l]fluoranthene is C1=CC=C2C(=C1)C3=CC=CC=C3C4=C2C5=CC=CC6=C5C4=CC=C6.
What is the InChIKey of Dibenzo[j,l]fluoranthene?
The InChIKey is JYVYSXOKKXPQHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H14/c1-3-11-18-16(9-1)17-10-2-4-12-19(17)24-21-14-6-8-15-7-5-13-20(22(15)21)23(18)24/h1-14H.
What are the key properties of Dibenzo[j,l]fluoranthene?
Dibenzo[j,l]fluoranthene has a molecular weight of 302.40 g/mol, XLogP of 7.70, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for Dibenzo[j,l]fluoranthene is sourced from PubChem (CID 6428082), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).