C50H38O2P2 — CID 134550611
2'-diphenylphosphoryl-7'-[(4-methylcyclohexa-2,4-dien-1-yl)-phenylphosphoryl]-9,9'-spirobi[fluorene] (PubChem CID 134550611) has the molecular formula C50H38O2P2 and a molecular weight of 732.80 g/mol. Its IUPAC name is 2'-diphenylphosphoryl-7'-[(4-methylcyclohexa-2,4-dien-1-yl)-phenylphosphoryl]-9,9'-spirobi[fluorene].
| Compound Name | 2'-diphenylphosphoryl-7'-[(4-methylcyclohexa-2,4-dien-1-yl)-phenylphosphoryl]-9,9'-spirobi[fluorene] |
|---|---|
| PubChem CID | 134550611 |
| Molecular Formula | C50H38O2P2 |
| Molecular Weight | 732.80 g/mol |
| Exact Mass | 732.23 |
| IUPAC Name | 2'-diphenylphosphoryl-7'-[(4-methylcyclohexa-2,4-dien-1-yl)-phenylphosphoryl]-9,9'-spirobi[fluorene] |
| SMILES | CC1=CCC(P(=O)(c2ccccc2)c2ccc3c(c2)C2(c4ccccc4-c4ccccc42)c2cc(P(=O)(c4ccccc4)c4ccccc4)ccc2-3)C=C1 |
| InChI | InChI=1S/C50H38O2P2/c1-35-25-27-39(28-26-35)54(52,38-19-9-4-10-20-38)41-30-32-45-44-31-29-40(53(51,36-15-5-2-6-16-36)37-17-7-3-8-18-37)33-48(44)50(49(45)34-41)46-23-13-11-21-42(46)43-22-12-14-24-47(43)50/h2-27,29-34,39H,28H2,1H3 |
| InChIKey | IJDWPINTSMWLSN-UHFFFAOYSA-N |
| XLogP | 10.26 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.80 |
| LogP ≤ 5 | 10.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|