C41H21F12OP — CID 88865297
2-bis[3,5-bis(trifluoromethyl)phenyl]phosphoryl-9,9'-spirobi[fluorene] (PubChem CID 88865297) has the molecular formula C41H21F12OP and a molecular weight of 788.57 g/mol. Its IUPAC name is 2-bis[3,5-bis(trifluoromethyl)phenyl]phosphoryl-9,9'-spirobi[fluorene].
| Compound Name | 2-bis[3,5-bis(trifluoromethyl)phenyl]phosphoryl-9,9'-spirobi[fluorene] |
|---|---|
| PubChem CID | 88865297 |
| Molecular Formula | C41H21F12OP |
| Molecular Weight | 788.57 g/mol |
| Exact Mass | 788.11 |
| IUPAC Name | 2-bis[3,5-bis(trifluoromethyl)phenyl]phosphoryl-9,9'-spirobi[fluorene] |
| SMILES | O=P(c1cc(C(F)(F)F)cc(C(F)(F)F)c1)(c1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1ccc2c(c1)C1(c3ccccc3-c3ccccc31)c1ccccc1-2 |
| InChI | InChI=1S/C41H21F12OP/c42-38(43,44)22-15-23(39(45,46)47)18-27(17-22)55(54,28-19-24(40(48,49)50)16-25(20-28)41(51,52)53)26-13-14-32-31-9-3-6-12-35(31)37(36(32)21-26)33-10-4-1-7-29(33)30-8-2-5-11-34(30)37/h1-21H |
| InChIKey | MCTYSMHULFCMAO-UHFFFAOYSA-N |
| XLogP | 11.74 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 788.57 |
| LogP ≤ 5 | 11.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|