C50H42O2P2 — CID 134550587
(2R)-2,7-bis(diphenylphosphoryl)-2'-methylspiro[1,2,3,4,4a,9a-hexahydrofluorene-9,9'-fluorene] (PubChem CID 134550587) has the molecular formula C50H42O2P2 and a molecular weight of 736.83 g/mol. Its IUPAC name is (2R)-2,7-bis(diphenylphosphoryl)-2'-methylspiro[1,2,3,4,4a,9a-hexahydrofluorene-9,9'-fluorene].
| Compound Name | (2R)-2,7-bis(diphenylphosphoryl)-2'-methylspiro[1,2,3,4,4a,9a-hexahydrofluorene-9,9'-fluorene] |
|---|---|
| PubChem CID | 134550587 |
| Molecular Formula | C50H42O2P2 |
| Molecular Weight | 736.83 g/mol |
| Exact Mass | 736.27 |
| IUPAC Name | (2R)-2,7-bis(diphenylphosphoryl)-2'-methylspiro[1,2,3,4,4a,9a-hexahydrofluorene-9,9'-fluorene] |
| SMILES | Cc1ccc2c(c1)C1(c3ccccc3-2)c2cc(P(=O)(c3ccccc3)c3ccccc3)ccc2C2CC[C@@H](P(=O)(c3ccccc3)c3ccccc3)CC21 |
| InChI | InChI=1S/C50H42O2P2/c1-35-26-29-43-42-24-14-15-25-46(42)50(47(43)32-35)48-33-40(53(51,36-16-6-2-7-17-36)37-18-8-3-9-19-37)27-30-44(48)45-31-28-41(34-49(45)50)54(52,38-20-10-4-11-21-38)39-22-12-5-13-23-39/h2-27,29-30,32-33,41,45,49H,28,31,34H2,1H3/t41-,45?,49?,50?/m1/s1 |
| InChIKey | JNVSMSCHZLXYQD-YEIOJCIKSA-N |
| XLogP | 10.23 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.83 |
| LogP ≤ 5 | 10.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|