C63H54NOP — CID 131994025
6-bis[4-(9,9-dimethylfluoren-2-yl)phenyl]phosphoryl-3-(7,9,9-trimethylfluoren-2-yl)-1,2-dihydropyridine (PubChem CID 131994025) has the molecular formula C63H54NOP and a molecular weight of 872.11 g/mol. Its IUPAC name is 6-bis[4-(9,9-dimethylfluoren-2-yl)phenyl]phosphoryl-3-(7,9,9-trimethylfluoren-2-yl)-1,2-dihydropyridine.
| Compound Name | 6-bis[4-(9,9-dimethylfluoren-2-yl)phenyl]phosphoryl-3-(7,9,9-trimethylfluoren-2-yl)-1,2-dihydropyridine |
|---|---|
| PubChem CID | 131994025 |
| Molecular Formula | C63H54NOP |
| Molecular Weight | 872.11 g/mol |
| Exact Mass | 871.39 |
| IUPAC Name | 6-bis[4-(9,9-dimethylfluoren-2-yl)phenyl]phosphoryl-3-(7,9,9-trimethylfluoren-2-yl)-1,2-dihydropyridine |
| SMILES | Cc1ccc2c(c1)C(C)(C)c1cc(C3=CC=C(P(=O)(c4ccc(-c5ccc6c(c5)C(C)(C)c5ccccc5-6)cc4)c4ccc(-c5ccc6c(c5)C(C)(C)c5ccccc5-6)cc4)NC3)ccc1-2 |
| InChI | InChI=1S/C63H54NOP/c1-39-16-29-50-53-32-23-44(37-59(53)63(6,7)56(50)34-39)45-24-33-60(64-38-45)66(65,46-25-17-40(18-26-46)42-21-30-51-48-12-8-10-14-54(48)61(2,3)57(51)35-42)47-27-19-41(20-28-47)43-22-31-52-49-13-9-11-15-55(49)62(4,5)58(52)36-43/h8-37,64H,38H2,1-7H3 |
| InChIKey | UBSYTFWCKRWMEY-UHFFFAOYSA-N |
| XLogP | 15.09 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 872.11 |
| LogP ≤ 5 | 15.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|