C15H12ClN3O2 — CID 134551584
ethyl 6-chloro-2-phenylimidazo[1,2-b]pyridazine-8-carboxylate (PubChem CID 134551584) has the molecular formula C15H12ClN3O2 and a molecular weight of 301.73 g/mol. Its IUPAC name is ethyl 6-chloro-2-phenylimidazo[1,2-b]pyridazine-8-carboxylate.
| Compound Name | ethyl 6-chloro-2-phenylimidazo[1,2-b]pyridazine-8-carboxylate |
|---|---|
| PubChem CID | 134551584 |
| Molecular Formula | C15H12ClN3O2 |
| Molecular Weight | 301.73 g/mol |
| Exact Mass | 301.06 |
| IUPAC Name | ethyl 6-chloro-2-phenylimidazo[1,2-b]pyridazine-8-carboxylate |
| SMILES | CCOC(=O)c1cc(Cl)nn2cc(-c3ccccc3)nc12 |
| InChI | InChI=1S/C15H12ClN3O2/c1-2-21-15(20)11-8-13(16)18-19-9-12(17-14(11)19)10-6-4-3-5-7-10/h3-9H,2H2,1H3 |
| InChIKey | QPRMMWVKGFFOGG-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.73 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |