C16H18N6O4S2 — CID 13455326
(4R)-3-[(2S)-3-(1H-imidazol-5-yl)-2-[(2-nitrophenyl)sulfanylamino]propanoyl]-1,3-thiazolidine-4-carboxamide (PubChem CID 13455326) has the molecular formula C16H18N6O4S2 and a molecular weight of 422.49 g/mol. Its IUPAC name is (4R)-3-[(2S)-3-(1H-imidazol-5-yl)-2-[(2-nitrophenyl)sulfanylamino]propanoyl]-1,3-thiazolidine-4-carboxamide.
| Compound Name | (4R)-3-[(2S)-3-(1H-imidazol-5-yl)-2-[(2-nitrophenyl)sulfanylamino]propanoyl]-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 13455326 |
| Molecular Formula | C16H18N6O4S2 |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.08 |
| IUPAC Name | (4R)-3-[(2S)-3-(1H-imidazol-5-yl)-2-[(2-nitrophenyl)sulfanylamino]propanoyl]-1,3-thiazolidine-4-carboxamide |
| SMILES | NC(=O)[C@@H]1CSCN1C(=O)[C@H](Cc1cnc[nH]1)NSc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H18N6O4S2/c17-15(23)13-7-27-9-21(13)16(24)11(5-10-6-18-8-19-10)20-28-14-4-2-1-3-12(14)22(25)26/h1-4,6,8,11,13,20H,5,7,9H2,(H2,17,23)(H,18,19)/t11-,13-/m0/s1 |
| InChIKey | WIEXEDCDBQCNAF-AAEUAGOBSA-N |
| XLogP | 0.91 |
| TPSA | 147.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|