C19H36N2 — CID 134553445
(E)-3,3-dimethyl-N-(methylideneamino)-N-[(Z)-oct-2-en-3-yl]oct-1-en-1-amine (PubChem CID 134553445) has the molecular formula C19H36N2 and a molecular weight of 292.51 g/mol. Its IUPAC name is (E)-3,3-dimethyl-N-(methylideneamino)-N-[(Z)-oct-2-en-3-yl]oct-1-en-1-amine.
| Compound Name | (E)-3,3-dimethyl-N-(methylideneamino)-N-[(Z)-oct-2-en-3-yl]oct-1-en-1-amine |
|---|---|
| PubChem CID | 134553445 |
| Molecular Formula | C19H36N2 |
| Molecular Weight | 292.51 g/mol |
| Exact Mass | 292.29 |
| IUPAC Name | (E)-3,3-dimethyl-N-(methylideneamino)-N-[(Z)-oct-2-en-3-yl]oct-1-en-1-amine |
| SMILES | C=NN(/C=C/C(C)(C)CCCCC)/C(=C\C)CCCCC |
| InChI | InChI=1S/C19H36N2/c1-7-10-12-14-18(9-3)21(20-6)17-16-19(4,5)15-13-11-8-2/h9,16-17H,6-8,10-15H2,1-5H3/b17-16+,18-9- |
| InChIKey | VGJVBDHZSTVVGZ-ACHVGLIOSA-N |
| XLogP | 6.51 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.51 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|