C11H9NO2 — CID 134556327
N-(4-formylphenyl)buta-2,3-dienamide (PubChem CID 134556327) has the molecular formula C11H9NO2 and a molecular weight of 187.20 g/mol. Its IUPAC name is N-(4-formylphenyl)buta-2,3-dienamide.
| Compound Name | N-(4-formylphenyl)buta-2,3-dienamide |
|---|---|
| PubChem CID | 134556327 |
| Molecular Formula | C11H9NO2 |
| Molecular Weight | 187.20 g/mol |
| Exact Mass | 187.06 |
| IUPAC Name | N-(4-formylphenyl)buta-2,3-dienamide |
| SMILES | C=C=CC(=O)Nc1ccc(C=O)cc1 |
| InChI | InChI=1S/C11H9NO2/c1-2-3-11(14)12-10-6-4-9(8-13)5-7-10/h3-8H,1H2,(H,12,14) |
| InChIKey | ZYRGYUZMEDYPFX-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.20 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|