C26H29N2O4P — CID 134562421
3-tert-butyl-4-(2,6-dimethoxyphenyl)-3-oxo-N-phenyl-2H-1,3λ5-benzazaphosphole-1-carboxamide (PubChem CID 134562421) has the molecular formula C26H29N2O4P and a molecular weight of 464.50 g/mol. Its IUPAC name is 3-tert-butyl-4-(2,6-dimethoxyphenyl)-3-oxo-N-phenyl-2H-1,3λ5-benzazaphosphole-1-carboxamide.
| Compound Name | 3-tert-butyl-4-(2,6-dimethoxyphenyl)-3-oxo-N-phenyl-2H-1,3λ5-benzazaphosphole-1-carboxamide |
|---|---|
| PubChem CID | 134562421 |
| Molecular Formula | C26H29N2O4P |
| Molecular Weight | 464.50 g/mol |
| Exact Mass | 464.19 |
| IUPAC Name | 3-tert-butyl-4-(2,6-dimethoxyphenyl)-3-oxo-N-phenyl-2H-1,3λ5-benzazaphosphole-1-carboxamide |
| SMILES | COc1cccc(OC)c1-c1cccc2c1P(=O)(C(C)(C)C)CN2C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C26H29N2O4P/c1-26(2,3)33(30)17-28(25(29)27-18-11-7-6-8-12-18)20-14-9-13-19(24(20)33)23-21(31-4)15-10-16-22(23)32-5/h6-16H,17H2,1-5H3,(H,27,29) |
| InChIKey | ZURGMPNGYXLFCS-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.50 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|