C19H23N2O3P — CID 134575325
3-tert-butyl-4-methoxy-3-oxo-N-phenyl-2H-1,3λ5-benzazaphosphole-1-carboxamide (PubChem CID 134575325) has the molecular formula C19H23N2O3P and a molecular weight of 358.38 g/mol. Its IUPAC name is 3-tert-butyl-4-methoxy-3-oxo-N-phenyl-2H-1,3λ5-benzazaphosphole-1-carboxamide.
| Compound Name | 3-tert-butyl-4-methoxy-3-oxo-N-phenyl-2H-1,3λ5-benzazaphosphole-1-carboxamide |
|---|---|
| PubChem CID | 134575325 |
| Molecular Formula | C19H23N2O3P |
| Molecular Weight | 358.38 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | 3-tert-butyl-4-methoxy-3-oxo-N-phenyl-2H-1,3λ5-benzazaphosphole-1-carboxamide |
| SMILES | COc1cccc2c1P(=O)(C(C)(C)C)CN2C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C19H23N2O3P/c1-19(2,3)25(23)13-21(15-11-8-12-16(24-4)17(15)25)18(22)20-14-9-6-5-7-10-14/h5-12H,13H2,1-4H3,(H,20,22) |
| InChIKey | LNLSBSVMCDVNKD-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.38 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|