C19H23N2O2P — CID 134562428
3-tert-butyl-4-methoxy-N-phenyl-2H-1,3-benzazaphosphole-1-carboxamide (PubChem CID 134562428) has the molecular formula C19H23N2O2P and a molecular weight of 342.38 g/mol. Its IUPAC name is 3-tert-butyl-4-methoxy-N-phenyl-2H-1,3-benzazaphosphole-1-carboxamide.
| Compound Name | 3-tert-butyl-4-methoxy-N-phenyl-2H-1,3-benzazaphosphole-1-carboxamide |
|---|---|
| PubChem CID | 134562428 |
| Molecular Formula | C19H23N2O2P |
| Molecular Weight | 342.38 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | 3-tert-butyl-4-methoxy-N-phenyl-2H-1,3-benzazaphosphole-1-carboxamide |
| SMILES | COc1cccc2c1P(C(C)(C)C)CN2C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C19H23N2O2P/c1-19(2,3)24-13-21(15-11-8-12-16(23-4)17(15)24)18(22)20-14-9-6-5-7-10-14/h5-12H,13H2,1-4H3,(H,20,22) |
| InChIKey | NDXJEIOMEWLWBG-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.38 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|