C16H23O5P — CID 134563039
2-[(2S,3R)-3-tert-butyl-4-methoxy-3-oxo-2H-1,3λ5-benzoxaphosphol-2-yl]-2-methylpropanoic acid (PubChem CID 134563039) has the molecular formula C16H23O5P and a molecular weight of 326.33 g/mol. Its IUPAC name is 2-[(2S,3R)-3-tert-butyl-4-methoxy-3-oxo-2H-1,3λ5-benzoxaphosphol-2-yl]-2-methylpropanoic acid.
| Compound Name | 2-[(2S,3R)-3-tert-butyl-4-methoxy-3-oxo-2H-1,3λ5-benzoxaphosphol-2-yl]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 134563039 |
| Molecular Formula | C16H23O5P |
| Molecular Weight | 326.33 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | 2-[(2S,3R)-3-tert-butyl-4-methoxy-3-oxo-2H-1,3λ5-benzoxaphosphol-2-yl]-2-methylpropanoic acid |
| SMILES | COc1cccc2c1[P@](=O)(C(C)(C)C)[C@@H](C(C)(C)C(=O)O)O2 |
| InChI | InChI=1S/C16H23O5P/c1-15(2,3)22(19)12-10(20-6)8-7-9-11(12)21-14(22)16(4,5)13(17)18/h7-9,14H,1-6H3,(H,17,18)/t14-,22+/m0/s1 |
| InChIKey | PMHAPHFWYGCYRS-RCDICMHDSA-N |
| XLogP | 3.31 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.33 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|