C20H18FN5O — CID 134563963
3,4-dihydro-1H-2,7-naphthyridin-2-yl-(7-fluoro-5-phenyl-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-2-yl)methanone (PubChem CID 134563963) has the molecular formula C20H18FN5O and a molecular weight of 363.40 g/mol. Its IUPAC name is 3,4-dihydro-1H-2,7-naphthyridin-2-yl-(7-fluoro-5-phenyl-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-2-yl)methanone.
| Compound Name | 3,4-dihydro-1H-2,7-naphthyridin-2-yl-(7-fluoro-5-phenyl-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-2-yl)methanone |
|---|---|
| PubChem CID | 134563963 |
| Molecular Formula | C20H18FN5O |
| Molecular Weight | 363.40 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | 3,4-dihydro-1H-2,7-naphthyridin-2-yl-(7-fluoro-5-phenyl-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-2-yl)methanone |
| SMILES | O=C(c1nc2n(n1)C(c1ccccc1)CC2F)N1CCc2ccncc2C1 |
| InChI | InChI=1S/C20H18FN5O/c21-16-10-17(14-4-2-1-3-5-14)26-19(16)23-18(24-26)20(27)25-9-7-13-6-8-22-11-15(13)12-25/h1-6,8,11,16-17H,7,9-10,12H2 |
| InChIKey | KGMMKIOZSWAONC-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.40 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |