C22H21FN4O — CID 134563928
(7-fluoro-5-phenyl-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-2-yl)-(1,3,4,5-tetrahydro-2-benzazepin-2-yl)methanone (PubChem CID 134563928) has the molecular formula C22H21FN4O and a molecular weight of 376.44 g/mol. Its IUPAC name is (7-fluoro-5-phenyl-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-2-yl)-(1,3,4,5-tetrahydro-2-benzazepin-2-yl)methanone.
| Compound Name | (7-fluoro-5-phenyl-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-2-yl)-(1,3,4,5-tetrahydro-2-benzazepin-2-yl)methanone |
|---|---|
| PubChem CID | 134563928 |
| Molecular Formula | C22H21FN4O |
| Molecular Weight | 376.44 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | (7-fluoro-5-phenyl-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-2-yl)-(1,3,4,5-tetrahydro-2-benzazepin-2-yl)methanone |
| SMILES | O=C(c1nc2n(n1)C(c1ccccc1)CC2F)N1CCCc2ccccc2C1 |
| InChI | InChI=1S/C22H21FN4O/c23-18-13-19(16-8-2-1-3-9-16)27-21(18)24-20(25-27)22(28)26-12-6-11-15-7-4-5-10-17(15)14-26/h1-5,7-10,18-19H,6,11-14H2 |
| InChIKey | FXBOPTQVCKRQHS-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.44 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |