C18H17FN6O — CID 134563974
6,7-dihydro-5H-pyrazolo[1,5-a]pyrimidin-4-yl-(7-fluoro-5-phenyl-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-2-yl)methanone (PubChem CID 134563974) has the molecular formula C18H17FN6O and a molecular weight of 352.37 g/mol. Its IUPAC name is 6,7-dihydro-5H-pyrazolo[1,5-a]pyrimidin-4-yl-(7-fluoro-5-phenyl-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-2-yl)methanone.
| Compound Name | 6,7-dihydro-5H-pyrazolo[1,5-a]pyrimidin-4-yl-(7-fluoro-5-phenyl-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-2-yl)methanone |
|---|---|
| PubChem CID | 134563974 |
| Molecular Formula | C18H17FN6O |
| Molecular Weight | 352.37 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | 6,7-dihydro-5H-pyrazolo[1,5-a]pyrimidin-4-yl-(7-fluoro-5-phenyl-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-2-yl)methanone |
| SMILES | O=C(c1nc2n(n1)C(c1ccccc1)CC2F)N1CCCn2nccc21 |
| InChI | InChI=1S/C18H17FN6O/c19-13-11-14(12-5-2-1-3-6-12)25-17(13)21-16(22-25)18(26)23-9-4-10-24-15(23)7-8-20-24/h1-3,5-8,13-14H,4,9-11H2 |
| InChIKey | QAHSHCWOPGIANA-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 68.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.37 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |