C13H13FN2O3S — CID 134564312
(2S)-1-[N-(4-ethynylphenyl)-S-fluorosulfonimidoyl]pyrrolidine-2-carboxylic acid (PubChem CID 134564312) has the molecular formula C13H13FN2O3S and a molecular weight of 296.32 g/mol. Its IUPAC name is (2S)-1-[N-(4-ethynylphenyl)-S-fluorosulfonimidoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-1-[N-(4-ethynylphenyl)-S-fluorosulfonimidoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 134564312 |
| Molecular Formula | C13H13FN2O3S |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.06 |
| IUPAC Name | (2S)-1-[N-(4-ethynylphenyl)-S-fluorosulfonimidoyl]pyrrolidine-2-carboxylic acid |
| SMILES | C#Cc1ccc(N=S(=O)(F)N2CCC[C@H]2C(=O)O)cc1 |
| InChI | InChI=1S/C13H13FN2O3S/c1-2-10-5-7-11(8-6-10)15-20(14,19)16-9-3-4-12(16)13(17)18/h1,5-8,12H,3-4,9H2,(H,17,18)/t12-,20?/m0/s1 |
| InChIKey | SAWHQRIKVIYLJT-SVZXGPMESA-N |
| XLogP | 2.12 |
| TPSA | 69.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|