C29H38N2O2 — CID 134567197
(4R)-1-cyclopropyl-5-[3-ethanimidoyl-4-(oxan-2-ylamino)phenyl]-4-methyl-1-phenylhexan-2-one (PubChem CID 134567197) has the molecular formula C29H38N2O2 and a molecular weight of 446.64 g/mol. Its IUPAC name is (4R)-1-cyclopropyl-5-[3-ethanimidoyl-4-(oxan-2-ylamino)phenyl]-4-methyl-1-phenylhexan-2-one.
| Compound Name | (4R)-1-cyclopropyl-5-[3-ethanimidoyl-4-(oxan-2-ylamino)phenyl]-4-methyl-1-phenylhexan-2-one |
|---|---|
| PubChem CID | 134567197 |
| Molecular Formula | C29H38N2O2 |
| Molecular Weight | 446.64 g/mol |
| Exact Mass | 446.29 |
| IUPAC Name | (4R)-1-cyclopropyl-5-[3-ethanimidoyl-4-(oxan-2-ylamino)phenyl]-4-methyl-1-phenylhexan-2-one |
| SMILES | [H]/N=C(\C)c1cc(C(C)[C@H](C)CC(=O)C(c2ccccc2)C2CC2)ccc1NC1CCCCO1 |
| InChI | InChI=1S/C29H38N2O2/c1-19(17-27(32)29(23-12-13-23)22-9-5-4-6-10-22)20(2)24-14-15-26(25(18-24)21(3)30)31-28-11-7-8-16-33-28/h4-6,9-10,14-15,18-20,23,28-31H,7-8,11-13,16-17H2,1-3H3/b30-21+/t19-,20?,28?,29?/m1/s1 |
| InChIKey | LBLKBCYZIRBRHO-CKVYWTBJSA-N |
| XLogP | 6.91 |
| TPSA | 62.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.64 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|