C35H45F7O — CID 134568796
1,5,7-trifluoro-2-methyl-3-[(2Z,4E,7E)-1,1,3,8-tetrafluoro-2-methyl-5-[4-(5-methylnonan-2-yl)cyclohepta-1,3,6-trien-1-yl]nona-2,4,7-trienoxy]cyclohepta-1,4-diene (PubChem CID 134568796) has the molecular formula C35H45F7O and a molecular weight of 614.73 g/mol. Its IUPAC name is 1,5,7-trifluoro-2-methyl-3-[(2Z,4E,7E)-1,1,3,8-tetrafluoro-2-methyl-5-[4-(5-methylnonan-2-yl)cyclohepta-1,3,6-trien-1-yl]nona-2,4,7-trienoxy]cyclohepta-1,4-diene.
| Compound Name | 1,5,7-trifluoro-2-methyl-3-[(2Z,4E,7E)-1,1,3,8-tetrafluoro-2-methyl-5-[4-(5-methylnonan-2-yl)cyclohepta-1,3,6-trien-1-yl]nona-2,4,7-trienoxy]cyclohepta-1,4-diene |
|---|---|
| PubChem CID | 134568796 |
| Molecular Formula | C35H45F7O |
| Molecular Weight | 614.73 g/mol |
| Exact Mass | 614.34 |
| IUPAC Name | 1,5,7-trifluoro-2-methyl-3-[(2Z,4E,7E)-1,1,3,8-tetrafluoro-2-methyl-5-[4-(5-methylnonan-2-yl)cyclohepta-1,3,6-trien-1-yl]nona-2,4,7-trienoxy]cyclohepta-1,4-diene |
| SMILES | CCCCC(C)CCC(C)C1=CC=C(/C(=C/C(F)=C(\C)C(F)(F)OC2C=C(F)CC(F)C(F)=C2C)C/C=C(\C)F)C=CC1 |
| InChI | InChI=1S/C35H45F7O/c1-7-8-10-22(2)13-14-23(3)27-11-9-12-28(18-17-27)29(16-15-24(4)36)19-31(38)26(6)35(41,42)43-33-21-30(37)20-32(39)34(40)25(33)5/h9,12,15,17-19,21-23,32-33H,7-8,10-11,13-14,16,20H2,1-6H3/b24-15+,29-19+,31-26- |
| InChIKey | QMXPPIQFWKOAPM-YGBBWHDGSA-N |
| XLogP | 12.29 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.73 |
| LogP ≤ 5 | 12.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|