C19H27F3O — CID 56623291
2-(4-pentylcyclohexen-1-yl)-5-(2,2,2-trifluoroethoxy)cyclohexa-1,3-diene (PubChem CID 56623291) has the molecular formula C19H27F3O and a molecular weight of 328.42 g/mol. Its IUPAC name is 2-(4-pentylcyclohexen-1-yl)-5-(2,2,2-trifluoroethoxy)cyclohexa-1,3-diene.
| Compound Name | 2-(4-pentylcyclohexen-1-yl)-5-(2,2,2-trifluoroethoxy)cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 56623291 |
| Molecular Formula | C19H27F3O |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | 2-(4-pentylcyclohexen-1-yl)-5-(2,2,2-trifluoroethoxy)cyclohexa-1,3-diene |
| SMILES | CCCCCC1CC=C(C2=CCC(OCC(F)(F)F)C=C2)CC1 |
| InChI | InChI=1S/C19H27F3O/c1-2-3-4-5-15-6-8-16(9-7-15)17-10-12-18(13-11-17)23-14-19(20,21)22/h8,10-12,15,18H,2-7,9,13-14H2,1H3 |
| InChIKey | RPXOGRWPQMXRBI-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|