C26H49N3 — CID 134570240
2-N-methyl-1-N-(3-methylidenehex-1-en-2-yl)-1-N-(5-non-1-en-2-ylpiperidin-3-yl)butane-1,2-diamine (PubChem CID 134570240) has the molecular formula C26H49N3 and a molecular weight of 403.70 g/mol. Its IUPAC name is 2-N-methyl-1-N-(3-methylidenehex-1-en-2-yl)-1-N-(5-non-1-en-2-ylpiperidin-3-yl)butane-1,2-diamine.
| Compound Name | 2-N-methyl-1-N-(3-methylidenehex-1-en-2-yl)-1-N-(5-non-1-en-2-ylpiperidin-3-yl)butane-1,2-diamine |
|---|---|
| PubChem CID | 134570240 |
| Molecular Formula | C26H49N3 |
| Molecular Weight | 403.70 g/mol |
| Exact Mass | 403.39 |
| IUPAC Name | 2-N-methyl-1-N-(3-methylidenehex-1-en-2-yl)-1-N-(5-non-1-en-2-ylpiperidin-3-yl)butane-1,2-diamine |
| SMILES | C=C(CCC)C(=C)N(CC(CC)NC)C1CNCC(C(=C)CCCCCCC)C1 |
| InChI | InChI=1S/C26H49N3/c1-8-11-12-13-14-16-22(5)24-17-26(19-28-18-24)29(20-25(10-3)27-7)23(6)21(4)15-9-2/h24-28H,4-6,8-20H2,1-3,7H3 |
| InChIKey | KQTFXVBEESNAGM-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.70 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|