About 1-(5,5-difluorooxan-2-yl)-2-methylpropan-1-one
1-(5,5-difluorooxan-2-yl)-2-methylpropan-1-one (PubChem CID 134570924) has the molecular formula C9H14F2O2
and a molecular weight of 192.20 g/mol. Its IUPAC name is 1-(5,5-difluorooxan-2-yl)-2-methylpropan-1-one.
Molecular Properties
| Compound Name | 1-(5,5-difluorooxan-2-yl)-2-methylpropan-1-one |
| PubChem CID | 134570924 |
| Molecular Formula | C9H14F2O2 |
| Molecular Weight | 192.20 g/mol |
| Exact Mass | 192.10 |
| IUPAC Name | 1-(5,5-difluorooxan-2-yl)-2-methylpropan-1-one |
| SMILES | CC(C)C(=O)C1CCC(F)(F)CO1 |
| InChI | InChI=1S/C9H14F2O2/c1-6(2)8(12)7-3-4-9(10,11)5-13-7/h6-7H,3-5H2,1-2H3 |
| InChIKey | ZVFSQONMMZMLGV-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.20 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(5,5-difluorooxan-2-yl)-2-methylpropan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5,5-difluorooxan-2-yl)-2-methylpropan-1-one?
The IUPAC name of 1-(5,5-difluorooxan-2-yl)-2-methylpropan-1-one (CID 134570924) is 1-(5,5-difluorooxan-2-yl)-2-methylpropan-1-one.
What is the SMILES notation for 1-(5,5-difluorooxan-2-yl)-2-methylpropan-1-one?
The canonical SMILES for 1-(5,5-difluorooxan-2-yl)-2-methylpropan-1-one is CC(C)C(=O)C1CCC(F)(F)CO1.
What is the InChIKey of 1-(5,5-difluorooxan-2-yl)-2-methylpropan-1-one?
The InChIKey is ZVFSQONMMZMLGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14F2O2/c1-6(2)8(12)7-3-4-9(10,11)5-13-7/h6-7H,3-5H2,1-2H3.
What are the key properties of 1-(5,5-difluorooxan-2-yl)-2-methylpropan-1-one?
1-(5,5-difluorooxan-2-yl)-2-methylpropan-1-one has a molecular weight of 192.20 g/mol, XLogP of 2.03, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5,5-difluorooxan-2-yl)-2-methylpropan-1-one is sourced from PubChem (CID 134570924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).