C28H36F3N3O7 — CID 134581691
2-(2,6-dioxopiperidin-3-yl)-5-[4-[3,3,3-trifluoro-2-[2-(5-hydroxypentoxy)ethoxy]propyl]piperidin-1-yl]isoindole-1,3-dione (PubChem CID 134581691) has the molecular formula C28H36F3N3O7 and a molecular weight of 583.60 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-5-[4-[3,3,3-trifluoro-2-[2-(5-hydroxypentoxy)ethoxy]propyl]piperidin-1-yl]isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-5-[4-[3,3,3-trifluoro-2-[2-(5-hydroxypentoxy)ethoxy]propyl]piperidin-1-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 134581691 |
| Molecular Formula | C28H36F3N3O7 |
| Molecular Weight | 583.60 g/mol |
| Exact Mass | 583.25 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-5-[4-[3,3,3-trifluoro-2-[2-(5-hydroxypentoxy)ethoxy]propyl]piperidin-1-yl]isoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3ccc(N4CCC(CC(OCCOCCCCCO)C(F)(F)F)CC4)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C28H36F3N3O7/c29-28(30,31)23(41-15-14-40-13-3-1-2-12-35)16-18-8-10-33(11-9-18)19-4-5-20-21(17-19)27(39)34(26(20)38)22-6-7-24(36)32-25(22)37/h4-5,17-18,22-23,35H,1-3,6-16H2,(H,32,36,37) |
| InChIKey | VYFGWNGDUWFHNE-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 125.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.60 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|