C28H31N3O7S — CID 169092478
3-[1-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]piperidin-4-yl]-1-(2-methylphenyl)propane-1-sulfonic acid (PubChem CID 169092478) has the molecular formula C28H31N3O7S and a molecular weight of 553.64 g/mol. Its IUPAC name is 3-[1-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]piperidin-4-yl]-1-(2-methylphenyl)propane-1-sulfonic acid.
| Compound Name | 3-[1-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]piperidin-4-yl]-1-(2-methylphenyl)propane-1-sulfonic acid |
|---|---|
| PubChem CID | 169092478 |
| Molecular Formula | C28H31N3O7S |
| Molecular Weight | 553.64 g/mol |
| Exact Mass | 553.19 |
| IUPAC Name | 3-[1-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]piperidin-4-yl]-1-(2-methylphenyl)propane-1-sulfonic acid |
| SMILES | Cc1ccccc1C(CCC1CCN(c2ccc3c(c2)C(=O)N(C2CCC(=O)NC2=O)C3=O)CC1)S(=O)(=O)O |
| InChI | InChI=1S/C28H31N3O7S/c1-17-4-2-3-5-20(17)24(39(36,37)38)10-6-18-12-14-30(15-13-18)19-7-8-21-22(16-19)28(35)31(27(21)34)23-9-11-25(32)29-26(23)33/h2-5,7-8,16,18,23-24H,6,9-15H2,1H3,(H,29,32,33)(H,36,37,38) |
| InChIKey | KCJYYCAHSMMQHJ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 141.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.64 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|