C22H28N4O3 — CID 134584596
4-[[1-(3-methoxyphenyl)-4-(oxetan-3-yl)piperazin-2-yl]methyl]benzohydrazide (PubChem CID 134584596) has the molecular formula C22H28N4O3 and a molecular weight of 396.49 g/mol. Its IUPAC name is 4-[[1-(3-methoxyphenyl)-4-(oxetan-3-yl)piperazin-2-yl]methyl]benzohydrazide.
| Compound Name | 4-[[1-(3-methoxyphenyl)-4-(oxetan-3-yl)piperazin-2-yl]methyl]benzohydrazide |
|---|---|
| PubChem CID | 134584596 |
| Molecular Formula | C22H28N4O3 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.22 |
| IUPAC Name | 4-[[1-(3-methoxyphenyl)-4-(oxetan-3-yl)piperazin-2-yl]methyl]benzohydrazide |
| SMILES | COc1cccc(N2CCN(C3COC3)CC2Cc2ccc(C(=O)NN)cc2)c1 |
| InChI | InChI=1S/C22H28N4O3/c1-28-21-4-2-3-18(12-21)26-10-9-25(20-14-29-15-20)13-19(26)11-16-5-7-17(8-6-16)22(27)24-23/h2-8,12,19-20H,9-11,13-15,23H2,1H3,(H,24,27) |
| InChIKey | BLVKDXBZQYUBCN-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 80.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|