C21H33N3O4 — CID 171321851
formic acid;(1S,5R)-7-[1-(3-methoxyphenyl)piperidin-4-yl]-9-methyl-3-oxa-7,9-diazabicyclo[3.3.2]decane (PubChem CID 171321851) has the molecular formula C21H33N3O4 and a molecular weight of 391.51 g/mol. Its IUPAC name is formic acid;(1S,5R)-7-[1-(3-methoxyphenyl)piperidin-4-yl]-9-methyl-3-oxa-7,9-diazabicyclo[3.3.2]decane.
| Compound Name | formic acid;(1S,5R)-7-[1-(3-methoxyphenyl)piperidin-4-yl]-9-methyl-3-oxa-7,9-diazabicyclo[3.3.2]decane |
|---|---|
| PubChem CID | 171321851 |
| Molecular Formula | C21H33N3O4 |
| Molecular Weight | 391.51 g/mol |
| Exact Mass | 391.25 |
| IUPAC Name | formic acid;(1S,5R)-7-[1-(3-methoxyphenyl)piperidin-4-yl]-9-methyl-3-oxa-7,9-diazabicyclo[3.3.2]decane |
| SMILES | COc1cccc(N2CCC(N3C[C@@H]4COC[C@H](C3)N(C)C4)CC2)c1.O=CO |
| InChI | InChI=1S/C20H31N3O2.CH2O2/c1-21-11-16-12-23(13-19(21)15-25-14-16)17-6-8-22(9-7-17)18-4-3-5-20(10-18)24-2;2-1-3/h3-5,10,16-17,19H,6-9,11-15H2,1-2H3;1H,(H,2,3)/t16-,19+;/m1./s1 |
| InChIKey | GDQSISZVYCJLBS-VWJDFLIZSA-N |
| XLogP | 1.63 |
| TPSA | 65.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.51 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|