C19H29N3O4 — CID 91772882
2-[(3R,4S)-3-[[1-(3-methoxyphenyl)piperidin-4-yl]amino]oxan-4-yl]oxyacetamide (PubChem CID 91772882) has the molecular formula C19H29N3O4 and a molecular weight of 363.46 g/mol. Its IUPAC name is 2-[(3R,4S)-3-[[1-(3-methoxyphenyl)piperidin-4-yl]amino]oxan-4-yl]oxyacetamide.
| Compound Name | 2-[(3R,4S)-3-[[1-(3-methoxyphenyl)piperidin-4-yl]amino]oxan-4-yl]oxyacetamide |
|---|---|
| PubChem CID | 91772882 |
| Molecular Formula | C19H29N3O4 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.22 |
| IUPAC Name | 2-[(3R,4S)-3-[[1-(3-methoxyphenyl)piperidin-4-yl]amino]oxan-4-yl]oxyacetamide |
| SMILES | COc1cccc(N2CCC(N[C@@H]3COCC[C@@H]3OCC(N)=O)CC2)c1 |
| InChI | InChI=1S/C19H29N3O4/c1-24-16-4-2-3-15(11-16)22-8-5-14(6-9-22)21-17-12-25-10-7-18(17)26-13-19(20)23/h2-4,11,14,17-18,21H,5-10,12-13H2,1H3,(H2,20,23)/t17-,18+/m1/s1 |
| InChIKey | IWTNBSKAERCLFY-MSOLQXFVSA-N |
| XLogP | 0.91 |
| TPSA | 86.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |