C19H28N2O5 — CID 154916341
formic acid;[(1S,5R)-9-methyl-3-oxa-7,9-diazabicyclo[3.3.2]decan-7-yl]-(3-propan-2-yloxyphenyl)methanone (PubChem CID 154916341) has the molecular formula C19H28N2O5 and a molecular weight of 364.44 g/mol. Its IUPAC name is formic acid;[(1S,5R)-9-methyl-3-oxa-7,9-diazabicyclo[3.3.2]decan-7-yl]-(3-propan-2-yloxyphenyl)methanone.
| Compound Name | formic acid;[(1S,5R)-9-methyl-3-oxa-7,9-diazabicyclo[3.3.2]decan-7-yl]-(3-propan-2-yloxyphenyl)methanone |
|---|---|
| PubChem CID | 154916341 |
| Molecular Formula | C19H28N2O5 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | formic acid;[(1S,5R)-9-methyl-3-oxa-7,9-diazabicyclo[3.3.2]decan-7-yl]-(3-propan-2-yloxyphenyl)methanone |
| SMILES | CC(C)Oc1cccc(C(=O)N2C[C@@H]3COC[C@H](C2)N(C)C3)c1.O=CO |
| InChI | InChI=1S/C18H26N2O3.CH2O2/c1-13(2)23-17-6-4-5-15(7-17)18(21)20-9-14-8-19(3)16(10-20)12-22-11-14;2-1-3/h4-7,13-14,16H,8-12H2,1-3H3;1H,(H,2,3)/t14-,16+;/m1./s1 |
| InChIKey | KXBFAEJTQYEQKI-XMZRARIVSA-N |
| XLogP | 1.58 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|