C16H20ClFN2O4 — CID 154916077
(3-chloro-5-fluorophenyl)-[(1S,5R)-9-methyl-3-oxa-7,9-diazabicyclo[3.3.2]decan-7-yl]methanone;formic acid (PubChem CID 154916077) has the molecular formula C16H20ClFN2O4 and a molecular weight of 358.80 g/mol. Its IUPAC name is (3-chloro-5-fluorophenyl)-[(1S,5R)-9-methyl-3-oxa-7,9-diazabicyclo[3.3.2]decan-7-yl]methanone;formic acid.
| Compound Name | (3-chloro-5-fluorophenyl)-[(1S,5R)-9-methyl-3-oxa-7,9-diazabicyclo[3.3.2]decan-7-yl]methanone;formic acid |
|---|---|
| PubChem CID | 154916077 |
| Molecular Formula | C16H20ClFN2O4 |
| Molecular Weight | 358.80 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | (3-chloro-5-fluorophenyl)-[(1S,5R)-9-methyl-3-oxa-7,9-diazabicyclo[3.3.2]decan-7-yl]methanone;formic acid |
| SMILES | CN1C[C@H]2COC[C@@H]1CN(C(=O)c1cc(F)cc(Cl)c1)C2.O=CO |
| InChI | InChI=1S/C15H18ClFN2O2.CH2O2/c1-18-5-10-6-19(7-14(18)9-21-8-10)15(20)11-2-12(16)4-13(17)3-11;2-1-3/h2-4,10,14H,5-9H2,1H3;1H,(H,2,3)/t10-,14+;/m1./s1 |
| InChIKey | SNEDFELLDGEDCS-LOSLGVLSSA-N |
| XLogP | 1.58 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.80 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|